Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3718 | Purity: >98% |
 | |
| Chemical structure of ATR inhibitor 1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1613200-51-3 |
|---|---|
| Purity | >98% |
| Formula | C16H12F2N8O |
| Mol Weight | 370.3163 |
| CoA | CoA of ATR inhibitor 1 |
| Smiles: | O=C(C1=C2N=CC(F)=CN2N=C1N)NC3=C(C4=CN=CN4C)C(F)=CN=C3 |
|---|
KEYWORDS: buy ATR inhibitor 1 | ATR inhibitor 1 supplier | purchase | cost | manufacturer | order | distributor | buy 1613200-51-3 | 1613200-51-3 supplier